C27H42ClN3O2 — CID 170563724
(3S,4aS,8aS)-2-[(2R)-3-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-hydroxypropyl]-N-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 170563724) has the molecular formula C27H42ClN3O2 and a molecular weight of 476.11 g/mol. Its IUPAC name is (3S,4aS,8aS)-2-[(2R)-3-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-hydroxypropyl]-N-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S,4aS,8aS)-2-[(2R)-3-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-hydroxypropyl]-N-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 170563724 |
| Molecular Formula | C27H42ClN3O2 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | (3S,4aS,8aS)-2-[(2R)-3-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-hydroxypropyl]-N-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | C[C@H](NC[C@@H](O)CN1C[C@H]2CCCC[C@H]2C[C@H]1C(=O)NC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H42ClN3O2/c1-19(20-11-13-23(28)14-12-20)29-16-25(32)18-31-17-22-8-6-5-7-21(22)15-26(31)27(33)30-24-9-3-2-4-10-24/h11-14,19,21-22,24-26,29,32H,2-10,15-18H2,1H3,(H,30,33)/t19-,21-,22+,25+,26-/m0/s1 |
| InChIKey | FDKVORQFPTZRHR-WFSJLAJTSA-N |
| XLogP | 4.68 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |