C42H45N5O2 — CID 170563770
4-tert-butyl-N-[4-(3,6-dihydro-2H-pyran-4-yl)-3-(2-trityltetrazol-5-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 170563770) has the molecular formula C42H45N5O2 and a molecular weight of 651.86 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-(3,6-dihydro-2H-pyran-4-yl)-3-(2-trityltetrazol-5-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[4-(3,6-dihydro-2H-pyran-4-yl)-3-(2-trityltetrazol-5-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 170563770 |
| Molecular Formula | C42H45N5O2 |
| Molecular Weight | 651.86 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 4-tert-butyl-N-[4-(3,6-dihydro-2H-pyran-4-yl)-3-(2-trityltetrazol-5-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)C1CCC(C(=O)Nc2ccc(C3=CCOCC3)c(-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c2)CC1 |
| InChI | InChI=1S/C42H45N5O2/c1-41(2,3)32-21-19-31(20-22-32)40(48)43-36-23-24-37(30-25-27-49-28-26-30)38(29-36)39-44-46-47(45-39)42(33-13-7-4-8-14-33,34-15-9-5-10-16-34)35-17-11-6-12-18-35/h4-18,23-25,29,31-32H,19-22,26-28H2,1-3H3,(H,43,48) |
| InChIKey | MCMHBWVGRUEZFP-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.86 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|