C9H17NO2 — CID 170563825
(3R,5S)-3-methoxy-5-prop-2-enoxypiperidine (PubChem CID 170563825) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (3R,5S)-3-methoxy-5-prop-2-enoxypiperidine.
| Compound Name | (3R,5S)-3-methoxy-5-prop-2-enoxypiperidine |
|---|---|
| PubChem CID | 170563825 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3R,5S)-3-methoxy-5-prop-2-enoxypiperidine |
| SMILES | C=CCO[C@@H]1CNC[C@H](OC)C1 |
| InChI | InChI=1S/C9H17NO2/c1-3-4-12-9-5-8(11-2)6-10-7-9/h3,8-10H,1,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | YMHJNDKJIDJPSX-BDAKNGLRSA-N |
| XLogP | 0.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|