About cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate
cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate (PubChem CID 170564696) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate |
| PubChem CID | 170564696 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate |
| SMILES | CN1C(=O)c2ccccc2C(C)(CC(=O)OC2CCCCC2)C1=O |
| InChI | InChI=1S/C19H23NO4/c1-19(12-16(21)24-13-8-4-3-5-9-13)15-11-7-6-10-14(15)17(22)20(2)18(19)23/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3 |
| InChIKey | PJYBDJKCNSADHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate?
The IUPAC name of cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate (CID 170564696) is cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate.
What is the SMILES notation for cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate?
The canonical SMILES for cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate is CN1C(=O)c2ccccc2C(C)(CC(=O)OC2CCCCC2)C1=O.
What is the InChIKey of cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate?
The InChIKey is PJYBDJKCNSADHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c1-19(12-16(21)24-13-8-4-3-5-9-13)15-11-7-6-10-14(15)17(22)20(2)18(19)23/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3.
What are the key properties of cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate?
cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate has a molecular weight of 329.40 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-(2,4-dimethyl-1,3-dioxoisoquinolin-4-yl)acetate is sourced from PubChem (CID 170564696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).