About cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate
cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate (PubChem CID 170564707) has the molecular formula C20H25NO4
and a molecular weight of 343.42 g/mol. Its IUPAC name is cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate |
| PubChem CID | 170564707 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate |
| SMILES | CCN1C(=O)c2ccccc2C(C)(CC(=O)OC2CCCCC2)C1=O |
| InChI | InChI=1S/C20H25NO4/c1-3-21-18(23)15-11-7-8-12-16(15)20(2,19(21)24)13-17(22)25-14-9-5-4-6-10-14/h7-8,11-12,14H,3-6,9-10,13H2,1-2H3 |
| InChIKey | LAHPULCMORUVHD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate?
The IUPAC name of cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate (CID 170564707) is cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate.
What is the SMILES notation for cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate?
The canonical SMILES for cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate is CCN1C(=O)c2ccccc2C(C)(CC(=O)OC2CCCCC2)C1=O.
What is the InChIKey of cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate?
The InChIKey is LAHPULCMORUVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO4/c1-3-21-18(23)15-11-7-8-12-16(15)20(2,19(21)24)13-17(22)25-14-9-5-4-6-10-14/h7-8,11-12,14H,3-6,9-10,13H2,1-2H3.
What are the key properties of cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate?
cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate has a molecular weight of 343.42 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-(2-ethyl-4-methyl-1,3-dioxoisoquinolin-4-yl)acetate is sourced from PubChem (CID 170564707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).