About methyl 2-phenyl-1,10-phenanthroline-4-carboxylate
methyl 2-phenyl-1,10-phenanthroline-4-carboxylate (PubChem CID 170564940) has the molecular formula C20H14N2O2
and a molecular weight of 314.34 g/mol. Its IUPAC name is methyl 2-phenyl-1,10-phenanthroline-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-phenyl-1,10-phenanthroline-4-carboxylate |
| PubChem CID | 170564940 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl 2-phenyl-1,10-phenanthroline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc2c1ccc1cccnc12 |
| InChI | InChI=1S/C20H14N2O2/c1-24-20(23)16-12-17(13-6-3-2-4-7-13)22-19-15(16)10-9-14-8-5-11-21-18(14)19/h2-12H,1H3 |
| InChIKey | PGGKPAJYAHGMGZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-phenyl-1,10-phenanthroline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenyl-1,10-phenanthroline-4-carboxylate?
The IUPAC name of methyl 2-phenyl-1,10-phenanthroline-4-carboxylate (CID 170564940) is methyl 2-phenyl-1,10-phenanthroline-4-carboxylate.
What is the SMILES notation for methyl 2-phenyl-1,10-phenanthroline-4-carboxylate?
The canonical SMILES for methyl 2-phenyl-1,10-phenanthroline-4-carboxylate is COC(=O)c1cc(-c2ccccc2)nc2c1ccc1cccnc12.
What is the InChIKey of methyl 2-phenyl-1,10-phenanthroline-4-carboxylate?
The InChIKey is PGGKPAJYAHGMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O2/c1-24-20(23)16-12-17(13-6-3-2-4-7-13)22-19-15(16)10-9-14-8-5-11-21-18(14)19/h2-12H,1H3.
What are the key properties of methyl 2-phenyl-1,10-phenanthroline-4-carboxylate?
methyl 2-phenyl-1,10-phenanthroline-4-carboxylate has a molecular weight of 314.34 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenyl-1,10-phenanthroline-4-carboxylate is sourced from PubChem (CID 170564940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).