C14H12N2O4 — CID 170564950
dimethyl 6-pyridin-2-ylpyridine-2,4-dicarboxylate (PubChem CID 170564950) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is dimethyl 6-pyridin-2-ylpyridine-2,4-dicarboxylate.
| Compound Name | dimethyl 6-pyridin-2-ylpyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 170564950 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | dimethyl 6-pyridin-2-ylpyridine-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C14H12N2O4/c1-19-13(17)9-7-11(10-5-3-4-6-15-10)16-12(8-9)14(18)20-2/h3-8H,1-2H3 |
| InChIKey | AOMACKHHQZXHCW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |