C13H17N3O3S2 — CID 170565173
5-[2-(3,4-dimethoxyphenoxy)ethylsulfanylmethyl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 170565173) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxyphenoxy)ethylsulfanylmethyl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-(3,4-dimethoxyphenoxy)ethylsulfanylmethyl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 170565173 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 5-[2-(3,4-dimethoxyphenoxy)ethylsulfanylmethyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(OCCSCc2nc(=S)[nH][nH]2)cc1OC |
| InChI | InChI=1S/C13H17N3O3S2/c1-17-10-4-3-9(7-11(10)18-2)19-5-6-21-8-12-14-13(20)16-15-12/h3-4,7H,5-6,8H2,1-2H3,(H2,14,15,16,20) |
| InChIKey | PPCNANUPJHOOLA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|