C16H22N2O2S2 — CID 170565185
5-[(2-ethyl-3-phenoxypentyl)sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 170565185) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 5-[(2-ethyl-3-phenoxypentyl)sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[(2-ethyl-3-phenoxypentyl)sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 170565185 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-[(2-ethyl-3-phenoxypentyl)sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CCC(CSCc1n[nH]c(=S)o1)C(CC)Oc1ccccc1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-3-12(10-22-11-15-17-18-16(21)20-15)14(4-2)19-13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11H2,1-2H3,(H,18,21) |
| InChIKey | XRSOFRVQUPUXSB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|