C10H10FN3O2S — CID 170565229
3-[(3-fluorophenoxy)methylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 170565229) has the molecular formula C10H10FN3O2S and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-[(3-fluorophenoxy)methylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[(3-fluorophenoxy)methylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 170565229 |
| Molecular Formula | C10H10FN3O2S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-[(3-fluorophenoxy)methylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CSCOc2cccc(F)c2)[nH]1 |
| InChI | InChI=1S/C10H10FN3O2S/c11-7-2-1-3-8(4-7)16-6-17-5-9-12-10(15)14-13-9/h1-4H,5-6H2,(H2,12,13,14,15) |
| InChIKey | CXONZVQUXPGSKL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|