C29H42N4O2 — CID 170565485
(E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-3-methyl-N-[(1-phenyltriazol-4-yl)methyl]pent-2-enamide (PubChem CID 170565485) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-3-methyl-N-[(1-phenyltriazol-4-yl)methyl]pent-2-enamide.
| Compound Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-3-methyl-N-[(1-phenyltriazol-4-yl)methyl]pent-2-enamide |
|---|---|
| PubChem CID | 170565485 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | (E)-5-[(1R,4aS,6R,8aS)-6-hydroxy-2,5,5,8a-tetramethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]-3-methyl-N-[(1-phenyltriazol-4-yl)methyl]pent-2-enamide |
| SMILES | C/C(=C\C(=O)NCc1cn(-c2ccccc2)nn1)CC[C@@H]1C(C)CC[C@@H]2C(C)(C)[C@H](O)CC[C@@]12C |
| InChI | InChI=1S/C29H42N4O2/c1-20(17-27(35)30-18-22-19-33(32-31-22)23-9-7-6-8-10-23)11-13-24-21(2)12-14-25-28(3,4)26(34)15-16-29(24,25)5/h6-10,17,19,21,24-26,34H,11-16,18H2,1-5H3,(H,30,35)/b20-17+/t21?,24-,25-,26-,29+/m1/s1 |
| InChIKey | OTKPVEZIDSDIMG-AJVHWSQPSA-N |
| XLogP | 5.46 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|