C31H33N5O2 — CID 170566072
N,N-dimethyl-4-[5-[(7S)-7-(3-oxa-6-azabicyclo[3.1.1]heptan-6-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]benzamide (PubChem CID 170566072) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[(7S)-7-(3-oxa-6-azabicyclo[3.1.1]heptan-6-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]benzamide.
| Compound Name | N,N-dimethyl-4-[5-[(7S)-7-(3-oxa-6-azabicyclo[3.1.1]heptan-6-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 170566072 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | N,N-dimethyl-4-[5-[(7S)-7-(3-oxa-6-azabicyclo[3.1.1]heptan-6-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-yl]benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2[nH]nc3ncc(-c4ccc5c(c4)CC[C@@H](N4C6COCC4C6)CC5)cc23)cc1 |
| InChI | InChI=1S/C31H33N5O2/c1-35(2)31(37)21-6-4-20(5-7-21)29-28-14-24(16-32-30(28)34-33-29)23-8-3-19-9-11-25(12-10-22(19)13-23)36-26-15-27(36)18-38-17-26/h3-8,13-14,16,25-27H,9-12,15,17-18H2,1-2H3,(H,32,33,34)/t25-,26?,27?/m0/s1 |
| InChIKey | ZUFHZMHKCFCIHV-JRFCFUNGSA-N |
| XLogP | 4.71 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |