tetramethoxyazanium chloride

C4H12ClNO4 — CID 170567245

IUPACtetramethoxyazanium chloride
SMILESCO[N+](OC)(OC)OC.[Cl-]
InChIInChI=1S/C4H12NO4.ClH/c1-6-5(7-2,8-3)9-4;/h1-4H3;1H/q+1;/p-1
InChIKeyKZSDOMIDOXDWFU-UHFFFAOYSA-M
MW173.60 g/mol
LogP-2.95
Rot. Bonds4

About tetramethoxyazanium chloride

tetramethoxyazanium chloride (PubChem CID 170567245) has the molecular formula C4H12ClNO4 and a molecular weight of 173.60 g/mol. Its IUPAC name is tetramethoxyazanium chloride.

Molecular Properties

Compound Nametetramethoxyazanium chloride
PubChem CID170567245
Molecular FormulaC4H12ClNO4
Molecular Weight173.60 g/mol
Exact Mass173.05
IUPAC Nametetramethoxyazanium chloride
SMILESCO[N+](OC)(OC)OC.[Cl-]
InChIInChI=1S/C4H12NO4.ClH/c1-6-5(7-2,8-3)9-4;/h1-4H3;1H/q+1;/p-1
InChIKeyKZSDOMIDOXDWFU-UHFFFAOYSA-M
XLogP-2.95
TPSA36.92 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.60
LogP ≤ 5-2.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze tetramethoxyazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tetramethoxyazanium chloride?
The IUPAC name of tetramethoxyazanium chloride (CID 170567245) is tetramethoxyazanium chloride.
What is the SMILES notation for tetramethoxyazanium chloride?
The canonical SMILES for tetramethoxyazanium chloride is CO[N+](OC)(OC)OC.[Cl-].
What is the InChIKey of tetramethoxyazanium chloride?
The InChIKey is KZSDOMIDOXDWFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H12NO4.ClH/c1-6-5(7-2,8-3)9-4;/h1-4H3;1H/q+1;/p-1.
What are the key properties of tetramethoxyazanium chloride?
tetramethoxyazanium chloride has a molecular weight of 173.60 g/mol, XLogP of -2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethoxyazanium chloride is sourced from PubChem (CID 170567245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).