C29H59NO — CID 170567409
(Z)-N-butyl-N-methyl-8-(4-propyltridecan-3-yloxy)oct-6-en-1-amine (PubChem CID 170567409) has the molecular formula C29H59NO and a molecular weight of 437.80 g/mol. Its IUPAC name is (Z)-N-butyl-N-methyl-8-(4-propyltridecan-3-yloxy)oct-6-en-1-amine.
| Compound Name | (Z)-N-butyl-N-methyl-8-(4-propyltridecan-3-yloxy)oct-6-en-1-amine |
|---|---|
| PubChem CID | 170567409 |
| Molecular Formula | C29H59NO |
| Molecular Weight | 437.80 g/mol |
| Exact Mass | 437.46 |
| IUPAC Name | (Z)-N-butyl-N-methyl-8-(4-propyltridecan-3-yloxy)oct-6-en-1-amine |
| SMILES | CCCCCCCCCC(CCC)C(CC)OC/C=C\CCCCCN(C)CCCC |
| InChI | InChI=1S/C29H59NO/c1-6-10-12-13-14-17-20-24-28(23-8-3)29(9-4)31-27-22-19-16-15-18-21-26-30(5)25-11-7-2/h19,22,28-29H,6-18,20-21,23-27H2,1-5H3/b22-19- |
| InChIKey | UJCCRGGUUUXFCZ-QOCHGBHMSA-N |
| XLogP | 9.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.80 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|