About 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline
3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline (PubChem CID 170567506) has the molecular formula C22H23N3O
and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline.
Molecular Properties
| Compound Name | 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline |
| PubChem CID | 170567506 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline |
| SMILES | c1cncc(C[C@@H]2[C@@H](Oc3cc4ccccc4cn3)C3CCN2CC3)c1 |
| InChI | InChI=1S/C22H23N3O/c1-2-6-19-15-24-21(13-18(19)5-1)26-22-17-7-10-25(11-8-17)20(22)12-16-4-3-9-23-14-16/h1-6,9,13-15,17,20,22H,7-8,10-12H2/t20-,22+/m1/s1 |
| InChIKey | KHRMJWYROCGIKU-IRLDBZIGSA-N |
| XLogP | 3.71 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline?
The IUPAC name of 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline (CID 170567506) is 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline.
What is the SMILES notation for 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline?
The canonical SMILES for 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline is c1cncc(C[C@@H]2[C@@H](Oc3cc4ccccc4cn3)C3CCN2CC3)c1.
What is the InChIKey of 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline?
The InChIKey is KHRMJWYROCGIKU-IRLDBZIGSA-N. The full InChI is InChI=1S/C22H23N3O/c1-2-6-19-15-24-21(13-18(19)5-1)26-22-17-7-10-25(11-8-17)20(22)12-16-4-3-9-23-14-16/h1-6,9,13-15,17,20,22H,7-8,10-12H2/t20-,22+/m1/s1.
What are the key properties of 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline?
3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline has a molecular weight of 345.45 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]oxy]isoquinoline is sourced from PubChem (CID 170567506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).