C34H31Br2N — CID 170567518
N,N-bis(4-bromo-3-methylphenyl)-2,4-diphenylaniline;ethane (PubChem CID 170567518) has the molecular formula C34H31Br2N and a molecular weight of 613.44 g/mol. Its IUPAC name is N,N-bis(4-bromo-3-methylphenyl)-2,4-diphenylaniline;ethane.
| Compound Name | N,N-bis(4-bromo-3-methylphenyl)-2,4-diphenylaniline;ethane |
|---|---|
| PubChem CID | 170567518 |
| Molecular Formula | C34H31Br2N |
| Molecular Weight | 613.44 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | N,N-bis(4-bromo-3-methylphenyl)-2,4-diphenylaniline;ethane |
| SMILES | CC.Cc1cc(N(c2ccc(Br)c(C)c2)c2ccc(-c3ccccc3)cc2-c2ccccc2)ccc1Br |
| InChI | InChI=1S/C32H25Br2N.C2H6/c1-22-19-27(14-16-30(22)33)35(28-15-17-31(34)23(2)20-28)32-18-13-26(24-9-5-3-6-10-24)21-29(32)25-11-7-4-8-12-25;1-2/h3-21H,1-2H3;1-2H3 |
| InChIKey | AKEOSKLWYGDPQT-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.44 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |