C35H36BN2 — CID 170567788
CID 170567788 (PubChem CID 170567788) has the molecular formula C35H36BN2 and a molecular weight of 495.50 g/mol.
| Compound Name | CID 170567788 |
|---|---|
| PubChem CID | 170567788 |
| Molecular Formula | C35H36BN2 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | — |
| SMILES | C[B]c1cc2c(cc1-c1ccc(-c3nc4ccccc4n3-c3ccccc3)cc1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C35H36BN2/c1-33(2)27-21-26(29(36-7)22-28(27)34(3,4)35(33,5)6)23-17-19-24(20-18-23)32-37-30-15-11-12-16-31(30)38(32)25-13-9-8-10-14-25/h8-22H,1-7H3 |
| InChIKey | CQVWJNVFFHJTQZ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|