C8H8F3N3O2 — CID 170568139
4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl 2,2,2-trifluoroacetate (PubChem CID 170568139) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl 2,2,2-trifluoroacetate.
| Compound Name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170568139 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc2n(n1)CCNC2)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O2/c9-8(10,11)7(15)16-6-3-5-4-12-1-2-14(5)13-6/h3,12H,1-2,4H2 |
| InChIKey | XJEXOHJWHMMGTO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |