C26H26F5N3O5S — CID 170568326
ethyl 2-[(2,6-difluorophenyl)methyl-methylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate;2,2,2-trifluoroacetaldehyde (PubChem CID 170568326) has the molecular formula C26H26F5N3O5S and a molecular weight of 587.57 g/mol. Its IUPAC name is ethyl 2-[(2,6-difluorophenyl)methyl-methylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate;2,2,2-trifluoroacetaldehyde.
| Compound Name | ethyl 2-[(2,6-difluorophenyl)methyl-methylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 170568326 |
| Molecular Formula | C26H26F5N3O5S |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | ethyl 2-[(2,6-difluorophenyl)methyl-methylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylate;2,2,2-trifluoroacetaldehyde |
| SMILES | CCOC(=O)c1c(N(C)Cc2c(F)cccc2F)sc(-c2ccc([N+](=O)[O-])cc2)c1CN(C)C.O=CC(F)(F)F |
| InChI | InChI=1S/C24H25F2N3O4S.C2HF3O/c1-5-33-24(30)21-18(13-27(2)3)22(15-9-11-16(12-10-15)29(31)32)34-23(21)28(4)14-17-19(25)7-6-8-20(17)26;3-2(4,5)1-6/h6-12H,5,13-14H2,1-4H3;1H |
| InChIKey | VGKFNRVBNGCTDD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|