C25H29N3O4 — CID 170568659
[1-(4-methoxyphenyl)-3-pyridin-3-yloxypropan-2-yl] N-[[4-(dimethylamino)phenyl]methyl]carbamate (PubChem CID 170568659) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-3-pyridin-3-yloxypropan-2-yl] N-[[4-(dimethylamino)phenyl]methyl]carbamate.
| Compound Name | [1-(4-methoxyphenyl)-3-pyridin-3-yloxypropan-2-yl] N-[[4-(dimethylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170568659 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [1-(4-methoxyphenyl)-3-pyridin-3-yloxypropan-2-yl] N-[[4-(dimethylamino)phenyl]methyl]carbamate |
| SMILES | COc1ccc(CC(COc2cccnc2)OC(=O)NCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-28(2)21-10-6-20(7-11-21)16-27-25(29)32-24(18-31-23-5-4-14-26-17-23)15-19-8-12-22(30-3)13-9-19/h4-14,17,24H,15-16,18H2,1-3H3,(H,27,29) |
| InChIKey | STVZMXCQGWZDBP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|