About 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide
2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide (PubChem CID 170569570) has the molecular formula C14H24F2N2O2
and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide |
| PubChem CID | 170569570 |
| Molecular Formula | C14H24F2N2O2 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide |
| SMILES | C=C(C)OCCCC1CCN(CC(=O)NC)CC1(F)F |
| InChI | InChI=1S/C14H24F2N2O2/c1-11(2)20-8-4-5-12-6-7-18(9-13(19)17-3)10-14(12,15)16/h12H,1,4-10H2,2-3H3,(H,17,19) |
| InChIKey | MUCJYDLAOHWYPH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide?
The IUPAC name of 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide (CID 170569570) is 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide.
What is the SMILES notation for 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide?
The canonical SMILES for 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide is C=C(C)OCCCC1CCN(CC(=O)NC)CC1(F)F.
What is the InChIKey of 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide?
The InChIKey is MUCJYDLAOHWYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F2N2O2/c1-11(2)20-8-4-5-12-6-7-18(9-13(19)17-3)10-14(12,15)16/h12H,1,4-10H2,2-3H3,(H,17,19).
What are the key properties of 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide?
2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide has a molecular weight of 290.35 g/mol, XLogP of 2.02, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-difluoro-4-(3-prop-1-en-2-yloxypropyl)piperidin-1-yl]-N-methylacetamide is sourced from PubChem (CID 170569570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).