About 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen
2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen (PubChem CID 170569595) has the molecular formula C15H30F2N2O2
and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen.
Molecular Properties
| Compound Name | 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen |
| PubChem CID | 170569595 |
| Molecular Formula | C15H30F2N2O2 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen |
| SMILES | CCNC(=O)CN1CCC(CC(F)(F)COC(C)C)CC1.[H][H] |
| InChI | InChI=1S/C15H28F2N2O2.H2/c1-4-18-14(20)10-19-7-5-13(6-8-19)9-15(16,17)11-21-12(2)3;/h12-13H,4-11H2,1-3H3,(H,18,20);1H |
| InChIKey | ZYJCHERZGXIPGZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen?
The IUPAC name of 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen (CID 170569595) is 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen.
What is the SMILES notation for 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen?
The canonical SMILES for 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen is CCNC(=O)CN1CCC(CC(F)(F)COC(C)C)CC1.[H][H].
What is the InChIKey of 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen?
The InChIKey is ZYJCHERZGXIPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2N2O2.H2/c1-4-18-14(20)10-19-7-5-13(6-8-19)9-15(16,17)11-21-12(2)3;/h12-13H,4-11H2,1-3H3,(H,18,20);1H.
What are the key properties of 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen?
2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen has a molecular weight of 308.41 g/mol, XLogP of 2.53, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-difluoro-3-propan-2-yloxypropyl)piperidin-1-yl]-N-ethylacetamide;molecular hydrogen is sourced from PubChem (CID 170569595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).