C20H17ClF3N5OS3 — CID 170570066
7-chloro-N-[4-(1-oxo-3,4-dihydro-2H-thieno[3,2-f][1,5,2]dithiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 170570066) has the molecular formula C20H17ClF3N5OS3 and a molecular weight of 532.04 g/mol. Its IUPAC name is 7-chloro-N-[4-(1-oxo-3,4-dihydro-2H-thieno[3,2-f][1,5,2]dithiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | 7-chloro-N-[4-(1-oxo-3,4-dihydro-2H-thieno[3,2-f][1,5,2]dithiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 170570066 |
| Molecular Formula | C20H17ClF3N5OS3 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 7-chloro-N-[4-(1-oxo-3,4-dihydro-2H-thieno[3,2-f][1,5,2]dithiazepin-7-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | O=S1NCCSc2cc(-c3nc(Nc4cc5c(cc4Cl)CNCC5)ncc3C(F)(F)F)sc21 |
| InChI | InChI=1S/C20H17ClF3N5OS3/c21-13-5-11-8-25-2-1-10(11)6-14(13)28-19-26-9-12(20(22,23)24)17(29-19)15-7-16-18(32-15)33(30)27-3-4-31-16/h5-7,9,25,27H,1-4,8H2,(H,26,28,29) |
| InChIKey | GMRWROQREZUEJN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |