C27H34ClN5O6 — CID 170570506
4-amino-3-chlorobenzamide;2-[[(E)-but-2-enoyl]-[[2-(3,3-dimethylbutanoylamino)-2-phenylacetyl]amino]amino]acetic acid (PubChem CID 170570506) has the molecular formula C27H34ClN5O6 and a molecular weight of 560.05 g/mol. Its IUPAC name is 4-amino-3-chlorobenzamide;2-[[(E)-but-2-enoyl]-[[2-(3,3-dimethylbutanoylamino)-2-phenylacetyl]amino]amino]acetic acid.
| Compound Name | 4-amino-3-chlorobenzamide;2-[[(E)-but-2-enoyl]-[[2-(3,3-dimethylbutanoylamino)-2-phenylacetyl]amino]amino]acetic acid |
|---|---|
| PubChem CID | 170570506 |
| Molecular Formula | C27H34ClN5O6 |
| Molecular Weight | 560.05 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 4-amino-3-chlorobenzamide;2-[[(E)-but-2-enoyl]-[[2-(3,3-dimethylbutanoylamino)-2-phenylacetyl]amino]amino]acetic acid |
| SMILES | C/C=C/C(=O)N(CC(=O)O)NC(=O)C(NC(=O)CC(C)(C)C)c1ccccc1.NC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C20H27N3O5.C7H7ClN2O/c1-5-9-16(25)23(13-17(26)27)22-19(28)18(14-10-7-6-8-11-14)21-15(24)12-20(2,3)4;8-5-3-4(7(10)11)1-2-6(5)9/h5-11,18H,12-13H2,1-4H3,(H,21,24)(H,22,28)(H,26,27);1-3H,9H2,(H2,10,11)/b9-5+; |
| InChIKey | XITBLSJFPYPWAH-SZKNIZGXSA-N |
| XLogP | 2.82 |
| TPSA | 184.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.05 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|