C29H41ClF3N5O5 — CID 170570533
4-amino-3-chloro-N-(3,3-dimethyl-1-oxobutan-2-yl)benzamide;ethane;ethyl 2-[2-[2-(methylamino)-2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinyl]acetate (PubChem CID 170570533) has the molecular formula C29H41ClF3N5O5 and a molecular weight of 632.12 g/mol. Its IUPAC name is 4-amino-3-chloro-N-(3,3-dimethyl-1-oxobutan-2-yl)benzamide;ethane;ethyl 2-[2-[2-(methylamino)-2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinyl]acetate.
| Compound Name | 4-amino-3-chloro-N-(3,3-dimethyl-1-oxobutan-2-yl)benzamide;ethane;ethyl 2-[2-[2-(methylamino)-2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 170570533 |
| Molecular Formula | C29H41ClF3N5O5 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 4-amino-3-chloro-N-(3,3-dimethyl-1-oxobutan-2-yl)benzamide;ethane;ethyl 2-[2-[2-(methylamino)-2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinyl]acetate |
| SMILES | CC.CC(C)(C)C(C=O)NC(=O)c1ccc(N)c(Cl)c1.CCOC(=O)CNNC(=O)C(NC)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3N3O3.C13H17ClN2O2.C2H6/c1-3-23-11(21)8-19-20-13(22)12(18-2)9-5-4-6-10(7-9)14(15,16)17;1-13(2,3)11(7-17)16-12(18)8-4-5-10(15)9(14)6-8;1-2/h4-7,12,18-19H,3,8H2,1-2H3,(H,20,22);4-7,11H,15H2,1-3H3,(H,16,18);1-2H3 |
| InChIKey | KCYCWQFKDKDNCO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|