About ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane
ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane (PubChem CID 170571668) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane.
Molecular Properties
| Compound Name | ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane |
| PubChem CID | 170571668 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane |
| SMILES | CC.CN1CCOCC2(CCN2)C1 |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-10-4-5-11-7-8(6-10)2-3-9-8;1-2/h9H,2-7H2,1H3;1-2H3 |
| InChIKey | XVXDNXFJDRRIQW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane?
The IUPAC name of ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane (CID 170571668) is ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane.
What is the SMILES notation for ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane?
The canonical SMILES for ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane is CC.CN1CCOCC2(CCN2)C1.
What is the InChIKey of ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane?
The InChIKey is XVXDNXFJDRRIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H6/c1-10-4-5-11-7-8(6-10)2-3-9-8;1-2/h9H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane?
ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane has a molecular weight of 186.30 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-9-oxa-1,6-diazaspiro[3.6]decane is sourced from PubChem (CID 170571668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).