About 1,2-dimethylpyrrolidine;O-ethylhydroxylamine
1,2-dimethylpyrrolidine;O-ethylhydroxylamine (PubChem CID 170571763) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;O-ethylhydroxylamine.
Molecular Properties
| Compound Name | 1,2-dimethylpyrrolidine;O-ethylhydroxylamine |
| PubChem CID | 170571763 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 1,2-dimethylpyrrolidine;O-ethylhydroxylamine |
| SMILES | CC1CCCN1C.CCON |
| InChI | InChI=1S/C6H13N.C2H7NO/c1-6-4-3-5-7(6)2;1-2-4-3/h6H,3-5H2,1-2H3;2-3H2,1H3 |
| InChIKey | KSUDCGFGFIWFSH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpyrrolidine;O-ethylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrrolidine;O-ethylhydroxylamine?
The IUPAC name of 1,2-dimethylpyrrolidine;O-ethylhydroxylamine (CID 170571763) is 1,2-dimethylpyrrolidine;O-ethylhydroxylamine.
What is the SMILES notation for 1,2-dimethylpyrrolidine;O-ethylhydroxylamine?
The canonical SMILES for 1,2-dimethylpyrrolidine;O-ethylhydroxylamine is CC1CCCN1C.CCON.
What is the InChIKey of 1,2-dimethylpyrrolidine;O-ethylhydroxylamine?
The InChIKey is KSUDCGFGFIWFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2H7NO/c1-6-4-3-5-7(6)2;1-2-4-3/h6H,3-5H2,1-2H3;2-3H2,1H3.
What are the key properties of 1,2-dimethylpyrrolidine;O-ethylhydroxylamine?
1,2-dimethylpyrrolidine;O-ethylhydroxylamine has a molecular weight of 160.26 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrrolidine;O-ethylhydroxylamine is sourced from PubChem (CID 170571763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).