About 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium
1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (PubChem CID 170571803) has the molecular formula C8H15N2Rf-
and a molecular weight of 406.22 g/mol. Its IUPAC name is 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
Molecular Properties
| Compound Name | 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| PubChem CID | 170571803 |
| Molecular Formula | C8H15N2Rf- |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| SMILES | C[CH-]N1CCC12CCCN2.[Rf] |
| InChI | InChI=1S/C8H15N2.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;/h2,9H,3-7H2,1H3;/q-1; |
| InChIKey | NOTXEXPGVFVYSZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The IUPAC name of 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (CID 170571803) is 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
What is the SMILES notation for 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The canonical SMILES for 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium is C[CH-]N1CCC12CCCN2.[Rf].
What is the InChIKey of 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The InChIKey is NOTXEXPGVFVYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;/h2,9H,3-7H2,1H3;/q-1;.
What are the key properties of 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium has a molecular weight of 406.22 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium is sourced from PubChem (CID 170571803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).