C8H15N2Rf- — CID 170571803
1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (PubChem CID 170571803) has the molecular formula C8H15N2Rf- and a molecular weight of 406.22 g/mol. Its IUPAC name is 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
| Compound Name | 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
|---|---|
| PubChem CID | 170571803 |
| Molecular Formula | C8H15N2Rf- |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| SMILES | C[CH-]N1CCC12CCCN2.[Rf] |
| InChI | InChI=1S/C8H15N2.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;/h2,9H,3-7H2,1H3;/q-1; |
| InChIKey | NOTXEXPGVFVYSZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|