About ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium
ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (PubChem CID 170571838) has the molecular formula C10H21N2Rf-
and a molecular weight of 436.29 g/mol. Its IUPAC name is ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
Molecular Properties
| Compound Name | ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| PubChem CID | 170571838 |
| Molecular Formula | C10H21N2Rf- |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| SMILES | CC.C[CH-]N1CCC12CCCN2.[Rf] |
| InChI | InChI=1S/C8H15N2.C2H6.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;1-2;/h2,9H,3-7H2,1H3;1-2H3;/q-1;; |
| InChIKey | GARNEAFBLAXJEO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The IUPAC name of ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (CID 170571838) is ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
What is the SMILES notation for ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The canonical SMILES for ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium is CC.C[CH-]N1CCC12CCCN2.[Rf].
What is the InChIKey of ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
The InChIKey is GARNEAFBLAXJEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.C2H6.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;1-2;/h2,9H,3-7H2,1H3;1-2H3;/q-1;;.
What are the key properties of ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium?
ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium has a molecular weight of 436.29 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium is sourced from PubChem (CID 170571838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).