C10H21N2Rf- — CID 170571838
ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium (PubChem CID 170571838) has the molecular formula C10H21N2Rf- and a molecular weight of 436.29 g/mol. Its IUPAC name is ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium.
| Compound Name | ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
|---|---|
| PubChem CID | 170571838 |
| Molecular Formula | C10H21N2Rf- |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | ethane;1-ethyl-1,8-diazaspiro[3.4]octane;rutherfordium |
| SMILES | CC.C[CH-]N1CCC12CCCN2.[Rf] |
| InChI | InChI=1S/C8H15N2.C2H6.Rf/c1-2-10-7-5-8(10)4-3-6-9-8;1-2;/h2,9H,3-7H2,1H3;1-2H3;/q-1;; |
| InChIKey | GARNEAFBLAXJEO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|