About 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane
6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane (PubChem CID 170572217) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane.
Molecular Properties
| Compound Name | 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane |
| PubChem CID | 170572217 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane |
| SMILES | CC(C)N1CCOCC2(CCN2)C1 |
| InChI | InChI=1S/C10H20N2O/c1-9(2)12-5-6-13-8-10(7-12)3-4-11-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | WPHANDYHSMFYGF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane?
The IUPAC name of 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane (CID 170572217) is 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane.
What is the SMILES notation for 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane?
The canonical SMILES for 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane is CC(C)N1CCOCC2(CCN2)C1.
What is the InChIKey of 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane?
The InChIKey is WPHANDYHSMFYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-9(2)12-5-6-13-8-10(7-12)3-4-11-10/h9,11H,3-8H2,1-2H3.
What are the key properties of 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane?
6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane has a molecular weight of 184.28 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-9-oxa-1,6-diazaspiro[3.6]decane is sourced from PubChem (CID 170572217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).