About [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride
[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride (PubChem CID 170572346) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride.
Molecular Properties
| Compound Name | [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride |
| PubChem CID | 170572346 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride |
| SMILES | F.FOCC1(CN2CCCC2)CC1 |
| InChI | InChI=1S/C9H16FNO.FH/c10-12-8-9(3-4-9)7-11-5-1-2-6-11;/h1-8H2;1H |
| InChIKey | VCYDQFVJICGTPW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride?
The IUPAC name of [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride (CID 170572346) is [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride.
What is the SMILES notation for [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride?
The canonical SMILES for [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride is F.FOCC1(CN2CCCC2)CC1.
What is the InChIKey of [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride?
The InChIKey is VCYDQFVJICGTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FNO.FH/c10-12-8-9(3-4-9)7-11-5-1-2-6-11;/h1-8H2;1H.
What are the key properties of [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride?
[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride has a molecular weight of 193.24 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl hypofluorite;hydrofluoride is sourced from PubChem (CID 170572346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).