C31H42F2IN7OSi — CID 170573234
2-[[3-[2-(6-azaspiro[2.5]octan-6-yl)-4-iodophenyl]-5-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-1,2,4-triazol-4-yl]methoxy]ethyl-trimethylsilane (PubChem CID 170573234) has the molecular formula C31H42F2IN7OSi and a molecular weight of 721.71 g/mol. Its IUPAC name is 2-[[3-[2-(6-azaspiro[2.5]octan-6-yl)-4-iodophenyl]-5-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-1,2,4-triazol-4-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[2-(6-azaspiro[2.5]octan-6-yl)-4-iodophenyl]-5-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-1,2,4-triazol-4-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170573234 |
| Molecular Formula | C31H42F2IN7OSi |
| Molecular Weight | 721.71 g/mol |
| Exact Mass | 721.22 |
| IUPAC Name | 2-[[3-[2-(6-azaspiro[2.5]octan-6-yl)-4-iodophenyl]-5-[2-(4,4-difluoropiperidin-1-yl)-6-methylpyrimidin-4-yl]-1,2,4-triazol-4-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(-c2nnc(-c3ccc(I)cc3N3CCC4(CC3)CC4)n2COCC[Si](C)(C)C)nc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C31H42F2IN7OSi/c1-22-19-25(36-29(35-22)40-15-11-31(32,33)12-16-40)28-38-37-27(41(28)21-42-17-18-43(2,3)4)24-6-5-23(34)20-26(24)39-13-9-30(7-8-30)10-14-39/h5-6,19-20H,7-18,21H2,1-4H3 |
| InChIKey | OESBMHIIIAUQJX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.71 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|