C12H9N5O — CID 170573377
4-[6-(1,2-oxazol-3-yl)-2-pyridinyl]pyrimidin-2-amine (PubChem CID 170573377) has the molecular formula C12H9N5O and a molecular weight of 239.24 g/mol. Its IUPAC name is 4-[6-(1,2-oxazol-3-yl)-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | 4-[6-(1,2-oxazol-3-yl)-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170573377 |
| Molecular Formula | C12H9N5O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-[6-(1,2-oxazol-3-yl)-2-pyridinyl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2cccc(-c3ccon3)n2)n1 |
| InChI | InChI=1S/C12H9N5O/c13-12-14-6-4-10(16-12)8-2-1-3-9(15-8)11-5-7-18-17-11/h1-7H,(H2,13,14,16) |
| InChIKey | NJTHOWSZLZRITK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |