C22H19B5N8O3 — CID 170573475
CID 170573475 (PubChem CID 170573475) has the molecular formula C22H19B5N8O3 and a molecular weight of 497.51 g/mol.
| Compound Name | CID 170573475 |
|---|---|
| PubChem CID | 170573475 |
| Molecular Formula | C22H19B5N8O3 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | — |
| SMILES | CN1CCC(O)C1=O.[B]C([B])([B])C([B])([B])n1cc(Nc2nccc(-c3cccc(-c4ccon4)n3)n2)cn1 |
| InChI | InChI=1S/C17H10B5N7O.C5H9NO2/c18-16(19,20)17(21,22)29-9-10(8-24-29)25-15-23-6-4-13(27-15)11-2-1-3-12(26-11)14-5-7-30-28-14;1-6-3-2-4(7)5(6)8/h1-9H,(H,23,25,27);4,7H,2-3H2,1H3 |
| InChIKey | DIDUCOSSLARFJF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|