About CID 170573475
CID 170573475 (PubChem CID 170573475) has the molecular formula C22H19B5N8O3
and a molecular weight of 497.51 g/mol.
Molecular Properties
| Compound Name | CID 170573475 |
| PubChem CID | 170573475 |
| Molecular Formula | C22H19B5N8O3 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | — |
| SMILES | CN1CCC(O)C1=O.[B]C([B])([B])C([B])([B])n1cc(Nc2nccc(-c3cccc(-c4ccon4)n3)n2)cn1 |
| InChI | InChI=1S/C17H10B5N7O.C5H9NO2/c18-16(19,20)17(21,22)29-9-10(8-24-29)25-15-23-6-4-13(27-15)11-2-1-3-12(26-11)14-5-7-30-28-14;1-6-3-2-4(7)5(6)8/h1-9H,(H,23,25,27);4,7H,2-3H2,1H3 |
| InChIKey | DIDUCOSSLARFJF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 135.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170573475 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170573475?
The IUPAC name of CID 170573475 (CID 170573475) is not available.
What is the SMILES notation for CID 170573475?
The canonical SMILES for CID 170573475 is CN1CCC(O)C1=O.[B]C([B])([B])C([B])([B])n1cc(Nc2nccc(-c3cccc(-c4ccon4)n3)n2)cn1.
What is the InChIKey of CID 170573475?
The InChIKey is DIDUCOSSLARFJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10B5N7O.C5H9NO2/c18-16(19,20)17(21,22)29-9-10(8-24-29)25-15-23-6-4-13(27-15)11-2-1-3-12(26-11)14-5-7-30-28-14;1-6-3-2-4(7)5(6)8/h1-9H,(H,23,25,27);4,7H,2-3H2,1H3.
What are the key properties of CID 170573475?
CID 170573475 has a molecular weight of 497.51 g/mol, XLogP of -0.13, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170573475 is sourced from PubChem (CID 170573475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).