About 3-ethyl-1-methylpyrazole;propane
3-ethyl-1-methylpyrazole;propane (PubChem CID 170573719) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-ethyl-1-methylpyrazole;propane.
Molecular Properties
| Compound Name | 3-ethyl-1-methylpyrazole;propane |
| PubChem CID | 170573719 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-ethyl-1-methylpyrazole;propane |
| SMILES | CCC.CCc1ccn(C)n1 |
| InChI | InChI=1S/C6H10N2.C3H8/c1-3-6-4-5-8(2)7-6;1-3-2/h4-5H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | SIIDZZVRTLDHLY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1-methylpyrazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methylpyrazole;propane?
The IUPAC name of 3-ethyl-1-methylpyrazole;propane (CID 170573719) is 3-ethyl-1-methylpyrazole;propane.
What is the SMILES notation for 3-ethyl-1-methylpyrazole;propane?
The canonical SMILES for 3-ethyl-1-methylpyrazole;propane is CCC.CCc1ccn(C)n1.
What is the InChIKey of 3-ethyl-1-methylpyrazole;propane?
The InChIKey is SIIDZZVRTLDHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C3H8/c1-3-6-4-5-8(2)7-6;1-3-2/h4-5H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of 3-ethyl-1-methylpyrazole;propane?
3-ethyl-1-methylpyrazole;propane has a molecular weight of 154.26 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methylpyrazole;propane is sourced from PubChem (CID 170573719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).