C22H25N5O4S2 — CID 170573725
(3R)-3-hydroxy-1-methyl-3-[3-[4-[2-(3-methylsulfonylpropylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]phenyl]pyrrolidin-2-one (PubChem CID 170573725) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-methyl-3-[3-[4-[2-(3-methylsulfonylpropylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]phenyl]pyrrolidin-2-one.
| Compound Name | (3R)-3-hydroxy-1-methyl-3-[3-[4-[2-(3-methylsulfonylpropylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 170573725 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (3R)-3-hydroxy-1-methyl-3-[3-[4-[2-(3-methylsulfonylpropylamino)pyrimidin-4-yl]-1,3-thiazol-2-yl]phenyl]pyrrolidin-2-one |
| SMILES | CN1CC[C@@](O)(c2cccc(-c3nc(-c4ccnc(NCCCS(C)(=O)=O)n4)cs3)c2)C1=O |
| InChI | InChI=1S/C22H25N5O4S2/c1-27-11-8-22(29,20(27)28)16-6-3-5-15(13-16)19-25-18(14-32-19)17-7-10-24-21(26-17)23-9-4-12-33(2,30)31/h3,5-7,10,13-14,29H,4,8-9,11-12H2,1-2H3,(H,23,24,26)/t22-/m1/s1 |
| InChIKey | LJISBQPQTAUCGE-JOCHJYFZSA-N |
| XLogP | 2.16 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|