About (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine
(Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine (PubChem CID 170573857) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine |
| PubChem CID | 170573857 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine |
| SMILES | CC(=C/N)/C=N/C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-8(6-10)7-11-9-2-4-14(12,13)5-3-9/h6-7,9,12-13H,2-5,10H2,1H3/b8-6-,11-7+ |
| InChIKey | GCHYNPRMYZICRJ-FAWHLJIPSA-N |
| XLogP | 1.83 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine?
The IUPAC name of (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine (CID 170573857) is (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine.
What is the SMILES notation for (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine?
The canonical SMILES for (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine is CC(=C/N)/C=N/C1CCS(O)(O)CC1.
What is the InChIKey of (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine?
The InChIKey is GCHYNPRMYZICRJ-FAWHLJIPSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-8(6-10)7-11-9-2-4-14(12,13)5-3-9/h6-7,9,12-13H,2-5,10H2,1H3/b8-6-,11-7+.
What are the key properties of (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine?
(Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine has a molecular weight of 218.32 g/mol, XLogP of 1.83, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(1,1-dihydroxythian-4-yl)imino-2-methylprop-1-en-1-amine is sourced from PubChem (CID 170573857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).