About ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole
ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole (PubChem CID 170574391) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole |
| PubChem CID | 170574391 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole |
| SMILES | CC.CCN1C=C(C(C)C)C(C)N1 |
| InChI | InChI=1S/C9H18N2.C2H6/c1-5-11-6-9(7(2)3)8(4)10-11;1-2/h6-8,10H,5H2,1-4H3;1-2H3 |
| InChIKey | FULGIWMEELRXJQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole?
The IUPAC name of ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole (CID 170574391) is ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole.
What is the SMILES notation for ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole?
The canonical SMILES for ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole is CC.CCN1C=C(C(C)C)C(C)N1.
What is the InChIKey of ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole?
The InChIKey is FULGIWMEELRXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C2H6/c1-5-11-6-9(7(2)3)8(4)10-11;1-2/h6-8,10H,5H2,1-4H3;1-2H3.
What are the key properties of ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole?
ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole has a molecular weight of 184.33 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-5-methyl-4-propan-2-yl-1,5-dihydropyrazole is sourced from PubChem (CID 170574391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).