C19H18N4OS2 — CID 170574412
N-[[(2R)-7-oxa-1-thiaspiro[2.4]heptan-2-yl]methyl]-4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-amine (PubChem CID 170574412) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[[(2R)-7-oxa-1-thiaspiro[2.4]heptan-2-yl]methyl]-4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-[[(2R)-7-oxa-1-thiaspiro[2.4]heptan-2-yl]methyl]-4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170574412 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[[(2R)-7-oxa-1-thiaspiro[2.4]heptan-2-yl]methyl]-4-(2-phenyl-1,3-thiazol-4-yl)pyrimidin-2-amine |
| SMILES | c1ccc(-c2nc(-c3ccnc(NC[C@H]4SC45CCCO5)n3)cs2)cc1 |
| InChI | InChI=1S/C19H18N4OS2/c1-2-5-13(6-3-1)17-22-15(12-25-17)14-7-9-20-18(23-14)21-11-16-19(26-16)8-4-10-24-19/h1-3,5-7,9,12,16H,4,8,10-11H2,(H,20,21,23)/t16-,19?/m1/s1 |
| InChIKey | PDDKLOCVJTVXMI-VTBWFHPJSA-N |
| XLogP | 4.30 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|