About N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen
N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen (PubChem CID 170574744) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen |
| PubChem CID | 170574744 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen |
| SMILES | CCC(C)(C)c1cc(C(=O)NC)c(C)o1.[H][H] |
| InChI | InChI=1S/C12H19NO2.H2/c1-6-12(3,4)10-7-9(8(2)15-10)11(14)13-5;/h7H,6H2,1-5H3,(H,13,14);1H |
| InChIKey | KWFTZPNRGIIEFA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen?
The IUPAC name of N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen (CID 170574744) is N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen.
What is the SMILES notation for N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen?
The canonical SMILES for N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen is CCC(C)(C)c1cc(C(=O)NC)c(C)o1.[H][H].
What is the InChIKey of N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen?
The InChIKey is KWFTZPNRGIIEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2.H2/c1-6-12(3,4)10-7-9(8(2)15-10)11(14)13-5;/h7H,6H2,1-5H3,(H,13,14);1H.
What are the key properties of N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen?
N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen has a molecular weight of 211.30 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-5-(2-methylbutan-2-yl)furan-3-carboxamide;molecular hydrogen is sourced from PubChem (CID 170574744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).