About (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one
(4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one (PubChem CID 170574862) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one |
| PubChem CID | 170574862 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one |
| SMILES | C=C/C(=C1/CNC(=O)C1=C)C(C)(C)C |
| InChI | InChI=1S/C12H17NO/c1-6-10(12(3,4)5)9-7-13-11(14)8(9)2/h6H,1-2,7H2,3-5H3,(H,13,14)/b10-9+ |
| InChIKey | IUZKYWZADQZXAX-MDZDMXLPSA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one?
The IUPAC name of (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one (CID 170574862) is (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one.
What is the SMILES notation for (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one?
The canonical SMILES for (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one is C=C/C(=C1/CNC(=O)C1=C)C(C)(C)C.
What is the InChIKey of (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one?
The InChIKey is IUZKYWZADQZXAX-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H17NO/c1-6-10(12(3,4)5)9-7-13-11(14)8(9)2/h6H,1-2,7H2,3-5H3,(H,13,14)/b10-9+.
What are the key properties of (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one?
(4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one has a molecular weight of 191.27 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(4,4-dimethylpent-1-en-3-ylidene)-3-methylidenepyrrolidin-2-one is sourced from PubChem (CID 170574862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).