C14H27N3OS — CID 170575145
ethane;2-ethyl-4-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazole;formamide (PubChem CID 170575145) has the molecular formula C14H27N3OS and a molecular weight of 285.46 g/mol. Its IUPAC name is ethane;2-ethyl-4-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazole;formamide.
| Compound Name | ethane;2-ethyl-4-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazole;formamide |
|---|---|
| PubChem CID | 170575145 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethane;2-ethyl-4-methyl-5-(pyrrolidin-1-ylmethyl)-1,3-thiazole;formamide |
| SMILES | CC.CCc1nc(C)c(CN2CCCC2)s1.NC=O |
| InChI | InChI=1S/C11H18N2S.C2H6.CH3NO/c1-3-11-12-9(2)10(14-11)8-13-6-4-5-7-13;1-2;2-1-3/h3-8H2,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | QZSIYXSQMUOTSZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|