C12H18N4O3 — CID 170575734
4-formamido-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide (PubChem CID 170575734) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-formamido-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-formamido-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170575734 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-formamido-N-(2-morpholin-4-ylethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=CNc1c[nH]c(C(=O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C12H18N4O3/c17-9-15-10-7-11(14-8-10)12(18)13-1-2-16-3-5-19-6-4-16/h7-9,14H,1-6H2,(H,13,18)(H,15,17) |
| InChIKey | DDAZRYXLLHLECV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|