C13H22N2 — CID 170576182
1-[(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-diazomethyl]-1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexane (PubChem CID 170576182) has the molecular formula C13H22N2 and a molecular weight of 226.46 g/mol. Its IUPAC name is 1-[(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-diazomethyl]-1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexane.
| Compound Name | 1-[(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-diazomethyl]-1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexane |
|---|---|
| PubChem CID | 170576182 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 226.46 g/mol |
| Exact Mass | 226.30 |
| IUPAC Name | 1-[(1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexyl)-diazomethyl]-1,2,2,3,3,4,4,5,5,6-decadeuteriocyclohexane |
| SMILES | [2H]C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])C(=[N+]=[N-])C1([2H])C([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C13H22N2/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D,8D2,9D,10D2,11D,12D |
| InChIKey | FFCRRVXFSCAGPA-BIRYXQITSA-N |
| XLogP | 3.82 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|