About 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine
6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine (PubChem CID 170576762) has the molecular formula C9H8ClFN4
and a molecular weight of 226.64 g/mol. Its IUPAC name is 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 170576762 |
| Molecular Formula | C9H8ClFN4 |
| Molecular Weight | 226.64 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine |
| SMILES | FC1CN(c2n[nH]c3cc(Cl)ncc23)C1 |
| InChI | InChI=1S/C9H8ClFN4/c10-8-1-7-6(2-12-8)9(14-13-7)15-3-5(11)4-15/h1-2,5H,3-4H2,(H,13,14) |
| InChIKey | OTZYFBBOFYFIRJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine (CID 170576762) is 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine is FC1CN(c2n[nH]c3cc(Cl)ncc23)C1.
What is the InChIKey of 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine?
The InChIKey is OTZYFBBOFYFIRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClFN4/c10-8-1-7-6(2-12-8)9(14-13-7)15-3-5(11)4-15/h1-2,5H,3-4H2,(H,13,14).
What are the key properties of 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine?
6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine has a molecular weight of 226.64 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(3-fluoroazetidin-1-yl)-1H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 170576762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).