C21H26ClF2N7O2 — CID 170577846
(3S)-1-[6-chloro-1-[2-(1,1-difluoroethyl)-6-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[4,3-c]pyridin-3-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 170577846) has the molecular formula C21H26ClF2N7O2 and a molecular weight of 481.94 g/mol. Its IUPAC name is (3S)-1-[6-chloro-1-[2-(1,1-difluoroethyl)-6-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[4,3-c]pyridin-3-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3S)-1-[6-chloro-1-[2-(1,1-difluoroethyl)-6-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[4,3-c]pyridin-3-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 170577846 |
| Molecular Formula | C21H26ClF2N7O2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (3S)-1-[6-chloro-1-[2-(1,1-difluoroethyl)-6-(2-methoxyethoxy)pyrimidin-4-yl]pyrazolo[4,3-c]pyridin-3-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | COCCOc1cc(-n2nc(N3CC[C@H](N(C)C)C3)c3cnc(Cl)cc32)nc(C(C)(F)F)n1 |
| InChI | InChI=1S/C21H26ClF2N7O2/c1-21(23,24)20-26-17(10-18(27-20)33-8-7-32-4)31-15-9-16(22)25-11-14(15)19(28-31)30-6-5-13(12-30)29(2)3/h9-11,13H,5-8,12H2,1-4H3/t13-/m0/s1 |
| InChIKey | LJOYWVOINRVMFW-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|