C16H21ClN2O — CID 170578256
N-[(2-chloro-4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide;ethane (PubChem CID 170578256) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is N-[(2-chloro-4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | N-[(2-chloro-4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 170578256 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-[(2-chloro-4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide;ethane |
| SMILES | C#Cc1ccc(CNC(=O)C2CCCN2)c(Cl)c1.CC |
| InChI | InChI=1S/C14H15ClN2O.C2H6/c1-2-10-5-6-11(12(15)8-10)9-17-14(18)13-4-3-7-16-13;1-2/h1,5-6,8,13,16H,3-4,7,9H2,(H,17,18);1-2H3 |
| InChIKey | VLLHTPYRHDOTJF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|