C25H31Cl2FN4OS — CID 170578483
1-[(5-cyclobutyl-1H-pyrazol-4-yl)sulfanyl]-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 170578483) has the molecular formula C25H31Cl2FN4OS and a molecular weight of 525.52 g/mol. Its IUPAC name is 1-[(5-cyclobutyl-1H-pyrazol-4-yl)sulfanyl]-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-[(5-cyclobutyl-1H-pyrazol-4-yl)sulfanyl]-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170578483 |
| Molecular Formula | C25H31Cl2FN4OS |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 1-[(5-cyclobutyl-1H-pyrazol-4-yl)sulfanyl]-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | CC1(C(NC(=O)C2CCN(Sc3cn[nH]c3C3CCC3)C2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C25H31Cl2FN4OS/c1-25(10-2-3-11-25)23(20-18(28)8-7-17(26)21(20)27)30-24(33)16-9-12-32(14-16)34-19-13-29-31-22(19)15-5-4-6-15/h7-8,13,15-16,23H,2-6,9-12,14H2,1H3,(H,29,31)(H,30,33) |
| InChIKey | VAVRJCNSSGEMTN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|