About 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane
2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane (PubChem CID 170578717) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane.
Molecular Properties
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane |
| PubChem CID | 170578717 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane |
| SMILES | C=C/C=C\c1oc(C(C)C)cc1C.CC |
| InChI | InChI=1S/C12H16O.C2H6/c1-5-6-7-11-10(4)8-12(13-11)9(2)3;1-2/h5-9H,1H2,2-4H3;1-2H3/b7-6-; |
| InChIKey | OFLQIEGPAFKNHO-NAFXZHHSSA-N |
| XLogP | 4.94 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane?
The IUPAC name of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane (CID 170578717) is 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane.
What is the SMILES notation for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane?
The canonical SMILES for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane is C=C/C=C\c1oc(C(C)C)cc1C.CC.
What is the InChIKey of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane?
The InChIKey is OFLQIEGPAFKNHO-NAFXZHHSSA-N. The full InChI is InChI=1S/C12H16O.C2H6/c1-5-6-7-11-10(4)8-12(13-11)9(2)3;1-2/h5-9H,1H2,2-4H3;1-2H3/b7-6-;.
What are the key properties of 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane?
2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane has a molecular weight of 206.33 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-buta-1,3-dienyl]-3-methyl-5-propan-2-ylfuran;ethane is sourced from PubChem (CID 170578717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).