C22H27ClF2N2O2 — CID 170579077
(1R)-3-acetamido-N-[(R)-1-bicyclo[2.2.1]heptanyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide (PubChem CID 170579077) has the molecular formula C22H27ClF2N2O2 and a molecular weight of 424.92 g/mol. Its IUPAC name is (1R)-3-acetamido-N-[(R)-1-bicyclo[2.2.1]heptanyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | (1R)-3-acetamido-N-[(R)-1-bicyclo[2.2.1]heptanyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 170579077 |
| Molecular Formula | C22H27ClF2N2O2 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (1R)-3-acetamido-N-[(R)-1-bicyclo[2.2.1]heptanyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CC(=O)NC1CC[C@@H](C(=O)N[C@@H](c2c(F)ccc(Cl)c2F)C23CCC(CC2)C3)C1 |
| InChI | InChI=1S/C22H27ClF2N2O2/c1-12(28)26-15-3-2-14(10-15)21(29)27-20(22-8-6-13(11-22)7-9-22)18-17(24)5-4-16(23)19(18)25/h4-5,13-15,20H,2-3,6-11H2,1H3,(H,26,28)(H,27,29)/t13?,14-,15?,20+,22?/m1/s1 |
| InChIKey | SXTYVRHFUMXJQF-XTKSURLLSA-N |
| XLogP | 4.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|